ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Pentafluorocinnamic acid |
|
اسم المنتج | Pentafluorocinnamic acid |
الاسم بالانجليزية | Pentafluorocinnamic acid;2,3,4,5,6-Pentafluorocinnamic acid;(2E)-3-(pentafluorophenyl)prop-2-enoate;(2E)-3-(pentafluorophenyl)prop-2-enoic acid;3-(pentafluorophenyl)prop-2-enoate |
الصيغة الجزيئية | C9H2F5O2 |
الوزن الجزيئي الغرامي | 237.1035 |
InChI | InChI=1/C9H3F5O2/c10-5-3(1-2-4(15)16)6(11)8(13)9(14)7(5)12/h1-2H,(H,15,16)/p-1 |
إستراتيجية المساعدة القطرية | 719-60-8 |
بنية جزيئية | |
درجة الإنصهار | 152-156℃ |
نقطة الغليان | 251.5°C at 760 mmHg |
نقطة الوميض | 105.9°C |
ضغط البخار | 0.0106mmHg at 25°C |
علامات على البضائع الخطرة | Xi##Irritant:; |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |