ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Hydroxy-6-methoxyacetophenone |
|
اسم المنتج | 2-Hydroxy-6-methoxyacetophenone |
الاسم بالانجليزية | 2-Hydroxy-6-methoxyacetophenone;1-(2-Hydroxy-6-methoxyphenyl)ethan-1-one;1-(2-hydroxy-6-methoxyphenyl)ethanone;2'-Hydroxy-6'-methoxyacetophenone |
الصيغة الجزيئية | C9H10O3 |
الوزن الجزيئي الغرامي | 166.1739 |
InChI | InChI=1/C9H10O3/c1-6(10)9-7(11)4-3-5-8(9)12-2/h3-5,11H,1-2H3 |
إستراتيجية المساعدة القطرية | 703-23-1 |
المفوضية الأوروبية رقم | 211-872-9 |
بنية جزيئية | |
كثافة | 1.158g/cm3 |
درجة الإنصهار | 58-60℃ |
نقطة الغليان | 259.5°C at 760 mmHg |
معامل الإنكسار | 1.537 |
نقطة الوميض | 108.1°C |
ضغط البخار | 0.00798mmHg at 25°C |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |