ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Alpha-Ethylphenethyl alcohol |
|
اسم المنتج | Alpha-Ethylphenethyl alcohol |
الاسم بالانجليزية | Alpha-Ethylphenethyl alcohol;1-Phenyl-2-butanol;1-phenylbutan-2-ol;(2S)-1-phenylbutan-2-ol;(2R)-1-phenylbutan-2-ol |
الصيغة الجزيئية | C10H14O |
الوزن الجزيئي الغرامي | 150.2176 |
InChI | InChI=1/C10H14O/c1-2-10(11)8-9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3/t10-/m1/s1 |
إستراتيجية المساعدة القطرية | 701-70-2 |
المفوضية الأوروبية رقم | 211-858-2 |
بنية جزيئية | |
كثافة | 0.98g/cm3 |
نقطة الغليان | 226.6°C at 760 mmHg |
معامل الإنكسار | 1.52 |
نقطة الوميض | 100°C |
ضغط البخار | 0.0459mmHg at 25°C |
شروط الأمن | S24/25##Avoid contact with skin and eyes.:; |
MSDS |