ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3,4-Dimethoxythiophenol |
|
اسم المنتج | 3,4-Dimethoxythiophenol |
الاسم بالانجليزية | 3,4-Dimethoxythiophenol;3,4-Dimethoxybenzenethiol |
الصيغة الجزيئية | C8H10O2S |
الوزن الجزيئي الغرامي | 170.22 |
InChI | InChI=1/C8H10O2S/c1-9-7-4-3-6(11)5-8(7)10-2/h3-5,11H,1-2H3 |
إستراتيجية المساعدة القطرية | 700-96-9 |
بنية جزيئية | |
كثافة | 1.19 |
نقطة الغليان | 110℃(1 torr) |
خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/38##Irritating to eyes and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |