ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-hydroxy-3,5-diiodobenzoic acid |
|
اسم المنتج | 4-hydroxy-3,5-diiodobenzoic acid |
الاسم بالانجليزية | 4-hydroxy-3,5-diiodobenzoic acid;3,5-Diiodo-4-hydroxybenzoic acid |
الصيغة الجزيئية | C7H4I2O3 |
الوزن الجزيئي الغرامي | 389.9138 |
InChI | InChI=1/C7H4I2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) |
إستراتيجية المساعدة القطرية | 618-76-8 |
المفوضية الأوروبية رقم | 210-562-0 |
بنية جزيئية | |
كثافة | 2.697g/cm3 |
نقطة الغليان | 346.4°C at 760 mmHg |
معامل الإنكسار | 1.784 |
نقطة الوميض | 163.3°C |
ضغط البخار | 2.19E-05mmHg at 25°C |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |