ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3,5-Diaminobenzoic acid dihydrochloride |
|
اسم المنتج | 3,5-Diaminobenzoic acid dihydrochloride |
الاسم بالانجليزية | 3,5-Diaminobenzoic acid dihydrochloride;Benzoic acid, 3,5-diamino-, hydrochloride (1:2);AI3-51087;NSC 57806;Benzoic acid, 3,5-diamino-, dihydrochloride |
الصيغة الجزيئية | C7H8N2O2.2HCl |
الوزن الجزيئي الغرامي | 225.07 |
InChI | InChI=1/C7H8N2O2.2ClH/c8-5-1-4(7(10)11)2-6(9)3-5;;/h1-3H,8-9H2,(H,10,11);2*1H |
إستراتيجية المساعدة القطرية | 618-56-4 |
المفوضية الأوروبية رقم | 210-556-8 |
بنية جزيئية | |
درجة الإنصهار | 300℃ |
شروط الأمن | S24/25##Avoid contact with skin and eyes.:; |
MSDS |