ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
617-05-0 Vanilicacidethylester; 97% |
|
اسم المنتج | Vanilicacidethylester; 97% |
الاسم بالانجليزية | Vanilicacidethylester; 97%;Vanilic acid ethyl ester;Ethyl vanillate;Ethyl 4-hydroxy-3-methoxybenzoate~Vanillic acid ethyl ester;4-Hydroxy-3-methoxybenzoic acid ethyl ester;ethyl 4-hydroxy-3-methoxybenzoate |
الصيغة الجزيئية | C10H12O4 |
الوزن الجزيئي الغرامي | 196.1999 |
InChI | InChI=1/C10H12O4/c1-3-14-10(12)7-4-5-8(11)9(6-7)13-2/h4-6,11H,3H2,1-2H3 |
إستراتيجية المساعدة القطرية | 617-05-0 |
المفوضية الأوروبية رقم | 210-503-9 |
بنية جزيئية | ![]() |
كثافة | 1.18g/cm3 |
درجة الإنصهار | 39-41℃ |
نقطة الغليان | 292°C at 760 mmHg |
معامل الإنكسار | 1.528 |
نقطة الوميض | 122.4°C |
ضغط البخار | 0.00108mmHg at 25°C |
شروط الأمن | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |