ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Aminohippuric acid |
|
اسم المنتج | 4-Aminohippuric acid |
الاسم بالانجليزية | 4-Aminohippuric acid;PAH;p-Aminohippuric Acid (1.00084);4-Aminohippuric acid = N-(4-Aminobenzoyl)-glycin;4-Aminohippuric acid;[N-(4-Aminobenzoyl)glycine];N-(4-Aminobenzoyl)glycine;N-(4-aminobenzoyl)-glycine;{[(4-aminophenyl)carbonyl]amino}acetate;p-Aminohippuric acid |
الصيغة الجزيئية | C9H9N2O3 |
الوزن الجزيئي الغرامي | 193.1799 |
InChI | InChI=1/C9H10N2O3/c10-7-3-1-6(2-4-7)9(14)11-5-8(12)13/h1-4H,5,10H2,(H,11,14)(H,12,13)/p-1 |
إستراتيجية المساعدة القطرية | 61-78-9 |
المفوضية الأوروبية رقم | 200-518-9 |
بنية جزيئية | |
درجة الإنصهار | 197-200℃ |
نقطة الغليان | 517.2°C at 760 mmHg |
نقطة الوميض | 266.6°C |
ضغط البخار | 1.6E-11mmHg at 25°C |
شروط الأمن | S24/25##Avoid contact with skin and eyes.:; |
MSDS |