ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58414-52-1 Methyl thiophene-3-acetate |
|
اسم المنتج | Methyl thiophene-3-acetate |
الاسم بالانجليزية | Methyl thiophene-3-acetate;Methyl 3-thienylacetate~Thiophene-3-acetic acid methyl ester;3-Thiopheneacetic acid methyl ester;methyl thiophen-3-ylacetate |
الصيغة الجزيئية | C7H8O2S |
الوزن الجزيئي الغرامي | 156.2022 |
InChI | InChI=1/C7H8O2S/c1-9-7(8)4-6-2-3-10-5-6/h2-3,5H,4H2,1H3 |
إستراتيجية المساعدة القطرية | 58414-52-1 |
المفوضية الأوروبية رقم | 261-242-2 |
بنية جزيئية | ![]() |
كثافة | 1.185g/cm3 |
نقطة الغليان | 210.4°C at 760 mmHg |
معامل الإنكسار | 1.528 |
نقطة الوميض | 81.1°C |
ضغط البخار | 0.193mmHg at 25°C |
شروط الأمن | S24/25##Avoid contact with skin and eyes.:; |
MSDS |