Chemindex > 578-46-1
SA ▼
578-46-1 5-Methyl-2-nitroaniline |
|
| اسم المنتج | 5-Methyl-2-nitroaniline |
| الاسم بالانجليزية | 5-Methyl-2-nitroaniline;3-Amino-4-nitrotoluene;6-Nitro-m-toluidine;5-Methyl-2-nitrophenylamine;5-Methyl-2-nitro phenylamine |
| الصيغة الجزيئية | C7H8N2O2 |
| الوزن الجزيئي الغرامي | 152.1506 |
| InChI | InChI=1/C7H8N2O2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,8H2,1H3 |
| إستراتيجية المساعدة القطرية | 578-46-1 |
| المفوضية الأوروبية رقم | 209-423-7 |
| بنية جزيئية |  |
| كثافة | 1.269g/cm3 |
| نقطة الغليان | 312.4°C at 760 mmHg |
| معامل الإنكسار | 1.615 |
| نقطة الوميض | 142.8°C |
| ضغط البخار | 0.000529mmHg at 25°C |
| خطر المصطلحات | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.||R51/53##Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:; |
| شروط الأمن | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:; |
| MSDS | |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة
ChemNet Mall
يتم توفير خدمة قاعدة بيانات CAS الكي&# 