Chemindex > 56-55-3
SA ▼
1,2-Benzanthracene |
|
| اسم المنتج | 1,2-Benzanthracene |
| الاسم بالانجليزية | 1,2-Benzanthracene;1,2-benzanthrene;2,3-benzophenanthracene;2,3-benzophenanthrene;B(A)A;benz[a]anthracene;Benz[a]anthracene;Benzanthracene;benzanthrene;Benzo[a]anthracene;Benzo[b]phenanthrene;naphthanthracene;tetraphene |
| الصيغة الجزيئية | C18H12 |
| الوزن الجزيئي الغرامي | 228.2879 |
| InChI | InChI=1/C18H12/c1-2-7-15-12-18-16(11-14(15)6-1)10-9-13-5-3-4-8-17(13)18/h1-12H |
| إستراتيجية المساعدة القطرية | 56-55-3 |
| المفوضية الأوروبية رقم | 200-280-6 |
| بنية جزيئية |  |
| كثافة | 1.19g/cm3 |
| درجة الإنصهار | 158-161℃ |
| نقطة الغليان | 436.7°C at 760 mmHg |
| معامل الإنكسار | 1.771 |
| نقطة الوميض | 209.1°C |
| الذوبان في الماء | 0.0000014 g/100 mL |
| ضغط البخار | 2.02E-07mmHg at 25°C |
| علامات على البضائع الخطرة |  T##Toxic||N##Dangerous for the environment:; |
| خطر المصطلحات | R45##May cause cancer.||R50/53##Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:; |
| شروط الأمن | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.||S60##This material and its container must be disposed of as hazardous waste.||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:; |
| MSDS | |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة
ChemNet Mall
يتم توفير خدمة قاعدة بيانات CAS الكي&# 