ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Carboxy-3,4-dimethoxybenzaldehyde |
|
اسم المنتج | 2-Carboxy-3,4-dimethoxybenzaldehyde |
الاسم بالانجليزية | 2-Carboxy-3,4-dimethoxybenzaldehyde;5,6-Dimethoxyphthalaldehydic acid~6-Formyl-2,3-dimethoxybenzoic acid~Opianic acid;6-formyl-2,3-dimethoxybenzoic acid |
الصيغة الجزيئية | C10H10O5 |
الوزن الجزيئي الغرامي | 210.1834 |
InChI | InChI=1/C10H10O5/c1-14-7-4-3-6(5-11)8(10(12)13)9(7)15-2/h3-5H,1-2H3,(H,12,13) |
إستراتيجية المساعدة القطرية | 519-05-1 |
المفوضية الأوروبية رقم | 208-261-4 |
بنية جزيئية | |
كثافة | 1.3g/cm3 |
نقطة الغليان | 386.3°C at 760 mmHg |
معامل الإنكسار | 1.573 |
نقطة الوميض | 155.1°C |
ضغط البخار | 1.17E-06mmHg at 25°C |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |