ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
tetraiodoethylene |
|
اسم المنتج | tetraiodoethylene |
الاسم بالانجليزية | tetraiodoethylene;diiodoform;tetraiodoethene |
الصيغة الجزيئية | C2I4 |
الوزن الجزيئي الغرامي | 531.6393 |
InChI | InChI=1/C2I4/c3-1(4)2(5)6 |
إستراتيجية المساعدة القطرية | 513-92-8 |
المفوضية الأوروبية رقم | 208-176-2 |
بنية جزيئية | |
كثافة | 4.087g/cm3 |
درجة الإنصهار | 191-193℃ |
نقطة الغليان | 288.3°C at 760 mmHg |
معامل الإنكسار | 1.952 |
نقطة الوميض | 139.9°C |
ضغط البخار | 0.00409mmHg at 25°C |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |