ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Hydroxybutyric acid, sodium salt |
|
اسم المنتج | 4-Hydroxybutyric acid, sodium salt |
الاسم بالانجليزية | 4-Hydroxybutyric acid, sodium salt;Sodium Oxybate;4-Hydroxybutyric acid sodium salt;Sodium 4-hydroxybutyrate;Gamma-Hydroxybutyrate Sodium Salt;sodium 4-hydroxybutanoate |
الصيغة الجزيئية | C4H7NaO3 |
الوزن الجزيئي الغرامي | 126.0863 |
InChI | InChI=1/C4H8O3.Na/c5-3-1-2-4(6)7;/h5H,1-3H2,(H,6,7);/q;+1/p-1 |
إستراتيجية المساعدة القطرية | 502-85-2 |
المفوضية الأوروبية رقم | 207-953-3 |
بنية جزيئية | |
درجة الإنصهار | 143-147℃ |
نقطة الغليان | 295.6°C at 760 mmHg |
نقطة الوميض | 146.8°C |
ضغط البخار | 0.000156mmHg at 25°C |
شروط الأمن | S24/25##Avoid contact with skin and eyes.:; |
MSDS |