ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Desyl chloride |
|
اسم المنتج | Desyl chloride |
الاسم بالانجليزية | Desyl chloride;alpha-Chloro-alpha-phenylacetophenone;alpha-chlorodeoxybenzoin;2-chloro-1,2-diphenylethanone;(2R)-2-chloro-1,2-diphenylethanone;(2S)-2-chloro-1,2-diphenylethanone |
الصيغة الجزيئية | C14H11ClO |
الوزن الجزيئي الغرامي | 230.6895 |
InChI | InChI=1/C14H11ClO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13H/t13-/m0/s1 |
إستراتيجية المساعدة القطرية | 447-31-4 |
المفوضية الأوروبية رقم | 207-181-7 |
بنية جزيئية | |
كثافة | 1.19g/cm3 |
درجة الإنصهار | 65-69℃ |
نقطة الغليان | 345.5°C at 760 mmHg |
معامل الإنكسار | 1.592 |
نقطة الوميض | 190.4°C |
ضغط البخار | 6.14E-05mmHg at 25°C |
علامات على البضائع الخطرة | Xn##Harmful:; |
خطر المصطلحات | R20/21##Harmful by inhalation and in contact with skin.||R37##Irritating to respiratory system.:; |
شروط الأمن | S22##Do not inhale dust.||S24##Avoid contact with skin.:; |
MSDS |