ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2'-fluoropropiophenone |
|
اسم المنتج | 2'-fluoropropiophenone |
الاسم بالانجليزية | 2'-fluoropropiophenone;2'-fluoro-1-phenylpropan-1-one;1-(2'-fluorophenyl)propan-1-one;2-Fluoropropiophenone |
الصيغة الجزيئية | C9H9FO |
الوزن الجزيئي الغرامي | 152.1656 |
InChI | InChI=1/C9H9FO/c1-2-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
إستراتيجية المساعدة القطرية | 446-22-0 |
المفوضية الأوروبية رقم | 244-220-7 |
بنية جزيئية | |
كثافة | 1.074g/cm3 |
نقطة الغليان | 204.119°C at 760 mmHg |
معامل الإنكسار | 1.489 |
نقطة الوميض | 77.067°C |
ضغط البخار | 0.268mmHg at 25°C |
خطر المصطلحات | R36/38##Irritating to eyes and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |