ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
446-09-3 2-Bromo-5-fluoronitrobenzene |
|
اسم المنتج | 2-Bromo-5-fluoronitrobenzene |
الاسم بالانجليزية | 2-Bromo-5-fluoronitrobenzene;1-Bromo-4-fluoro-2-nitrobenzene |
الصيغة الجزيئية | C6H3BrFNO2 |
الوزن الجزيئي الغرامي | 219.9959 |
InChI | InChI=1/C6H3BrFNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
إستراتيجية المساعدة القطرية | 446-09-3 |
المفوضية الأوروبية رقم | 207-160-2 |
بنية جزيئية | |
كثافة | 1.808g/cm3 |
درجة الإنصهار | 37-39℃ |
نقطة الغليان | 220.9°C at 760 mmHg |
معامل الإنكسار | 1.579 |
نقطة الوميض | 87.4°C |
ضغط البخار | 0.164mmHg at 25°C |
خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |