ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-(3-fluorophenyl)ethanol |
|
اسم المنتج | 1-(3-fluorophenyl)ethanol |
الاسم بالانجليزية | 1-(3-fluorophenyl)ethanol;3-fluorophenyl methyl carbinol;3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol;3-Fluoro-α-methylbenzenemethanol |
الصيغة الجزيئية | C8H9FO |
الوزن الجزيئي الغرامي | 140.1549 |
InChI | InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
إستراتيجية المساعدة القطرية | 402-63-1 |
المفوضية الأوروبية رقم | 206-950-4 |
بنية جزيئية | |
كثافة | 1.123g/cm3 |
نقطة الغليان | 196.2°C at 760 mmHg |
معامل الإنكسار | 1.51 |
نقطة الوميض | 90.1°C |
ضغط البخار | 0.251mmHg at 25°C |
شروط الأمن | S24/25##Avoid contact with skin and eyes.:; |
MSDS |