ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Alpha-Fluorocinnamic acid |
|
اسم المنتج | Alpha-Fluorocinnamic acid |
الاسم بالانجليزية | Alpha-Fluorocinnamic acid;Cinnamic acid, alpha-fluoro-;1-09-00-00237 (Beilstein Handbook Reference);2-Fluoro-3-phenyl-2-propenoic acid;BRN 2501318;NSC 102780;alpha-Fluorocinnamic acid;2-Propenoic acid, 2-fluoro-3-phenyl- (9CI);2-fluoro-3-phenylprop-2-enoic acid;(2Z)-2-fluoro-3-phenylprop-2-enoate;(2Z)-2-fluoro-3-phenylprop-2-enoic acid |
الصيغة الجزيئية | C9H7FO2 |
الوزن الجزيئي الغرامي | 166.1491 |
InChI | InChI=1/C9H7FO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-6H,(H,11,12)/b8-6- |
إستراتيجية المساعدة القطرية | 350-90-3 |
المفوضية الأوروبية رقم | 206-508-0 |
بنية جزيئية | |
كثافة | 1.275g/cm3 |
درجة الإنصهار | 156-160℃ |
نقطة الغليان | 289.3°C at 760 mmHg |
معامل الإنكسار | 1.585 |
نقطة الوميض | 128.7°C |
ضغط البخار | 0.00103mmHg at 25°C |
علامات على البضائع الخطرة | Xi##Irritant:; |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |