ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
349-01-9 2,4-dinitro-5-fluorotoluene |
|
اسم المنتج | 2,4-dinitro-5-fluorotoluene |
الاسم بالانجليزية | 2,4-dinitro-5-fluorotoluene;1-Fluoro-5-methyl-2,4-dinitrobenzene |
الصيغة الجزيئية | C7H5FN2O4 |
الوزن الجزيئي الغرامي | 200.124 |
InChI | InChI=1/C7H5FN2O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,1H3 |
إستراتيجية المساعدة القطرية | 349-01-9 |
بنية جزيئية | ![]() |
كثافة | 1.497g/cm3 |
درجة الإنصهار | 82℃ |
نقطة الغليان | 319°C at 760 mmHg |
معامل الإنكسار | 1.575 |
نقطة الوميض | 146.8°C |
ضغط البخار | 0.000649mmHg at 25°C |
علامات على البضائع الخطرة | |
خطر المصطلحات | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
شروط الأمن | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S38##In case of insufficient ventilation, wear suitable respiratory equipment.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |