Chemindex > 344-14-9
SA ▼
dimethyl fluoromalonate |
|
| اسم المنتج | dimethyl fluoromalonate |
| الاسم بالانجليزية | dimethyl fluoromalonate;Fluoromalonic acid dimethyl ester;dimethyl fluoropropanedioate;2-Fluoro-malonic acid dimethyl ester |
| الصيغة الجزيئية | C5H7FO4 |
| الوزن الجزيئي الغرامي | 150.1051 |
| InChI | InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
| إستراتيجية المساعدة القطرية | 344-14-9 |
| بنية جزيئية |  |
| كثافة | 1.211g/cm3 |
| نقطة الغليان | 140.3°C at 760 mmHg |
| معامل الإنكسار | 1.382 |
| نقطة الوميض | 38.4°C |
| ضغط البخار | 6.18mmHg at 25°C |
| خطر المصطلحات | R34##Causes burns.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة مول كيم نت للاستفسار عن سعر
dimethyl fluoromalonate 344-14-9
يتم توفير خدمة قاعدة بيانات CAS الكي&# 