ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33904-03-9 2,4-dimethoxyphenyl isothiocyanate |
|
اسم المنتج | 2,4-dimethoxyphenyl isothiocyanate |
الاسم بالانجليزية | 2,4-dimethoxyphenyl isothiocyanate; |
الصيغة الجزيئية | C9H9NO2S |
الوزن الجزيئي الغرامي | 195.2383 |
InChI | InChI=1/C9H9NO2S/c1-11-7-3-4-8(10-6-13)9(5-7)12-2/h3-5H,1-2H3 |
إستراتيجية المساعدة القطرية | 33904-03-9 |
بنية جزيئية | |
كثافة | 1.12g/cm3 |
درجة الإنصهار | 51℃ |
نقطة الغليان | 331°C at 760 mmHg |
معامل الإنكسار | 1.537 |
نقطة الوميض | 154°C |
ضغط البخار | 0.000308mmHg at 25°C |
علامات على البضائع الخطرة | Xn##Harmful:; |
خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |