33305-08-7 methyl 1,3-thiazolane-2-carboxylate hydrochloride |
اسم المنتج |
methyl 1,3-thiazolane-2-carboxylate hydrochloride |
الاسم بالانجليزية |
methyl 1,3-thiazolane-2-carboxylate hydrochloride;methyl 1,3-thiazolidine-2-carboxylate hydrochloride |
الصيغة الجزيئية |
C5H10ClNO2S |
الوزن الجزيئي الغرامي |
183.6564 |
InChI |
InChI=1/C5H9NO2S.ClH/c1-8-5(7)4-6-2-3-9-4;/h4,6H,2-3H2,1H3;1H |
إستراتيجية المساعدة القطرية |
33305-08-7 |
المفوضية الأوروبية رقم |
256-726-5 |
بنية جزيئية |
|
درجة الإنصهار |
159-163℃ (dec.) |
نقطة الغليان |
238.9°C at 760 mmHg |
نقطة الوميض |
98.3°C |
ضغط البخار |
0.0413mmHg at 25°C |
علامات على البضائع الخطرة |
Xn##Harmful:;
|
خطر المصطلحات |
R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:;
|
شروط الأمن |
S22||S24/25:;
|
MSDS |
Material Safety Data Sheet |