ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3-fluoro-4-methoxybenzonitrile |
|
اسم المنتج | 3-fluoro-4-methoxybenzonitrile |
الاسم بالانجليزية | 3-fluoro-4-methoxybenzonitrile;Fluoromethoxybenzonitrile |
الصيغة الجزيئية | C8H6FNO |
الوزن الجزيئي الغرامي | 151.1377 |
InChI | InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
إستراتيجية المساعدة القطرية | 331-62-4 |
بنية جزيئية | |
كثافة | 1.18g/cm3 |
نقطة الغليان | 254.3°C at 760 mmHg |
معامل الإنكسار | 1.505 |
نقطة الوميض | 107.6°C |
ضغط البخار | 0.0173mmHg at 25°C |
خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
شروط الأمن | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |