ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
325-50-8 5-Fluoro-2-methylphenylhydrazine hydrochloride |
|
اسم المنتج | 5-Fluoro-2-methylphenylhydrazine hydrochloride |
الاسم بالانجليزية | 5-Fluoro-2-methylphenylhydrazine hydrochloride;(5-fluoro-2-methylphenyl)diazanium chloride;(5-fluoro-2-methylphenyl)hydrazine;3-Fluoro-6-methylphenylhydrazine HCl;5-Fluoro-2-methylphenylhydrazine HCl |
الصيغة الجزيئية | C7H9FN2 |
الوزن الجزيئي الغرامي | 140.1582 |
InChI | InChI=1/C7H9FN2/c1-5-2-3-6(8)4-7(5)10-9/h2-4,10H,9H2,1H3 |
إستراتيجية المساعدة القطرية | 325-50-8 |
بنية جزيئية | |
كثافة | 1.202g/cm3 |
نقطة الغليان | 212°C at 760 mmHg |
معامل الإنكسار | 1.594 |
نقطة الوميض | 82°C |
ضغط البخار | 0.177mmHg at 25°C |
خطر المصطلحات | R20/22##Harmful by inhalation and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |