ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
320-65-0 2-fluorobenzal chloride |
|
اسم المنتج | 2-fluorobenzal chloride |
الاسم بالانجليزية | 2-fluorobenzal chloride;alpha,alpha-Dichloro-2-fluorotoluene |
الصيغة الجزيئية | C7H5Cl2F |
الوزن الجزيئي الغرامي | 179.02 |
InChI | InChI=1/C7H5Cl2F/c8-7(9)5-3-1-2-4-6(5)10/h1-4,7H |
إستراتيجية المساعدة القطرية | 320-65-0 |
المفوضية الأوروبية رقم | 206-279-7 |
بنية جزيئية | ![]() |
كثافة | 1.3 |
نقطة الغليان | 224℃ |
خطر المصطلحات | R34##Causes burns.||R36##Irritating to eyes.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |