ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-(Trifluoromethylsulfonyl)benzonitrile |
|
اسم المنتج | 4-(Trifluoromethylsulfonyl)benzonitrile |
الاسم بالانجليزية | 4-(Trifluoromethylsulfonyl)benzonitrile;4-Cyanophenyl trifluoromethyl sulphone;4-(Trifluoromethylsulphonyl)benzonitrile;4-(Trifluoromethanesulfonyl)benzonitrile |
الصيغة الجزيئية | C6H4FNO |
الوزن الجزيئي الغرامي | 125.1005 |
InChI | InChI=1/C6H4FNO/c7-5-2-1-3-8-6(5)4-9/h1-4H |
إستراتيجية المساعدة القطرية | 312-21-0 |
بنية جزيئية | |
كثافة | 1.269g/cm3 |
درجة الإنصهار | 84-88℃ |
نقطة الغليان | 166.5°C at 760 mmHg |
معامل الإنكسار | 1.543 |
نقطة الوميض | 54.5°C |
ضغط البخار | 1.78mmHg at 25°C |
خطر المصطلحات | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |