ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
26413-58-1 2-chloro-6-methylpyridine-4-carbonyl chloride |
|
اسم المنتج | 2-chloro-6-methylpyridine-4-carbonyl chloride |
الاسم بالانجليزية | 2-chloro-6-methylpyridine-4-carbonyl chloride; |
الصيغة الجزيئية | C7H5Cl2NO |
الوزن الجزيئي الغرامي | 190.0267 |
InChI | InChI=1/C7H5Cl2NO/c1-4-2-5(7(9)11)3-6(8)10-4/h2-3H,1H3 |
إستراتيجية المساعدة القطرية | 26413-58-1 |
بنية جزيئية | |
كثافة | 1.384g/cm3 |
نقطة الغليان | 270.3°C at 760 mmHg |
معامل الإنكسار | 1.558 |
نقطة الوميض | 117.3°C |
ضغط البخار | 0.00688mmHg at 25°C |
علامات على البضائع الخطرة | C##Corrosive:; |
خطر المصطلحات | R34##Causes burns.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |