ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Acridine |
|
اسم المنتج | Acridine |
الاسم بالانجليزية | Acridine;Dibenzo[b,e]pyridine |
الصيغة الجزيئية | C13H9N |
الوزن الجزيئي الغرامي | 179.2173 |
InChI | InChI=1/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
إستراتيجية المساعدة القطرية | 260-94-6 |
المفوضية الأوروبية رقم | 205-971-6 |
بنية جزيئية | |
كثافة | 1.187g/cm3 |
درجة الإنصهار | 105-110℃ |
نقطة الغليان | 346.7°C at 760 mmHg |
معامل الإنكسار | 1.726 |
نقطة الوميض | 153.8°C |
ضغط البخار | 0.000113mmHg at 25°C |
علامات على البضائع الخطرة | Xn##Harmful:; |
خطر المصطلحات | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |