ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
23141-61-9 6-Methyl-5-nitroquinoline |
|
اسم المنتج | 6-Methyl-5-nitroquinoline |
الاسم بالانجليزية | 6-Methyl-5-nitroquinoline;NSC 162892;6-methyl-5-nitro-isoquinoline |
الصيغة الجزيئية | C10H8N2O2 |
الوزن الجزيئي الغرامي | 188.18 |
InChI | InChI=1/C10H8N2O2/c1-7-2-3-8-6-11-5-4-9(8)10(7)12(13)14/h2-6H,1H3 |
إستراتيجية المساعدة القطرية | 23141-61-9 |
المفوضية الأوروبية رقم | 245-447-4 |
بنية جزيئية | |
كثافة | 1.298g/cm3 |
درجة الإنصهار | 117℃ |
نقطة الغليان | 342.4°C at 760 mmHg |
معامل الإنكسار | 1.661 |
نقطة الوميض | 160.9°C |
ضغط البخار | 0.00015mmHg at 25°C |
علامات على البضائع الخطرة | Xn##Harmful:; |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.||R40##Possible risks of irreversible effects.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |