Chemindex > 216394-06-8
SA ▼
216394-06-8 (1R,2R)-(-)-2-Benzyloxycyclohexylamine |
|
| اسم المنتج | (1R,2R)-(-)-2-Benzyloxycyclohexylamine |
| الاسم بالانجليزية | (1R,2R)-(-)-2-Benzyloxycyclohexylamine;(1R,2R)-(-)-1-Amino-2-benzyloxycyclohexane;(1R-trans)-(-)-2-(Phenylmethoxy)cyclohexanamine;(1R-trans)-2-(Phenylmethoxy)cyclohexaneamine;(1R,2R)-2-(benzyloxy)cyclohexanamine;(1R,2R)-2-phenylmethoxycyclohexan-1-amine |
| الصيغة الجزيئية | C13H19NO |
| الوزن الجزيئي الغرامي | 205.2961 |
| InChI | InChI=1/C13H19NO/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10,14H2/t12-,13-/m1/s1 |
| إستراتيجية المساعدة القطرية | 216394-06-8 |
| بنية جزيئية |  |
| كثافة | 1.039g/cm3 |
| نقطة الغليان | 306.148°C at 760 mmHg |
| معامل الإنكسار | 1.545 |
| نقطة الوميض | 133.224°C |
| ضغط البخار | 0.001mmHg at 25°C |
| خطر المصطلحات | R34##Causes burns.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة
ChemNet Mall
يتم توفير خدمة قاعدة بيانات CAS الكي&# 