ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
215-58-7 1,2,3,4-Dibenzanthracene |
|
اسم المنتج | 1,2,3,4-Dibenzanthracene |
الاسم بالانجليزية | 1,2,3,4-Dibenzanthracene;Dibenz[a,c]anthracene;dibenz(a,c)anthracene;1,2:3,4-dibenzanthracene;Benztriphenylene;2,3-Benztriphenylene;benzo[f]tetraphene |
الصيغة الجزيئية | C22H14 |
الوزن الجزيئي الغرامي | 278.3466 |
InChI | InChI=1/C22H14/c1-2-8-16-14-22-20-12-6-4-10-18(20)17-9-3-5-11-19(17)21(22)13-15(16)7-1/h1-14H |
إستراتيجية المساعدة القطرية | 215-58-7 |
المفوضية الأوروبية رقم | 205-920-8 |
بنية جزيئية | ![]() |
كثافة | 1.232g/cm3 |
درجة الإنصهار | 202-207℃ |
نقطة الغليان | 518°C at 760 mmHg |
معامل الإنكسار | 1.811 |
نقطة الوميض | 264.5°C |
ضغط البخار | 2.55E-10mmHg at 25°C |
علامات على البضائع الخطرة | |
خطر المصطلحات | R40##Possible risks of irreversible effects.:; |
شروط الأمن | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |