1643-28-3 3-(2-Chlorophenyl)propionic acid |
|
اسم المنتج | 3-(2-Chlorophenyl)propionic acid |
الاسم بالانجليزية | 3-(2-Chlorophenyl)propionic acid;Benzenepropanoic acid, 2-chloro-;2-Chlorobenzenepropanoic acid;3-(2-chlorophenyl)propanoic acid;3-(2-chlorophenyl)propanoate |
الصيغة الجزيئية | C9H8ClO2 |
الوزن الجزيئي الغرامي | 183.6122 |
InChI | InChI=1/C9H9ClO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12)/p-1 |
إستراتيجية المساعدة القطرية | 1643-28-3 |
بنية جزيئية | |
نقطة الغليان | 306.6°C at 760 mmHg |
نقطة الوميض | 139.2°C |
ضغط البخار | 0.000333mmHg at 25°C |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة
ChemNet Mall