1643-28-3 3-(2-Chlorophenyl)propionic acid |
|
Nama produk | 3-(2-Chlorophenyl)propionic acid |
Nama Inggeris | 3-(2-Chlorophenyl)propionic acid;Benzenepropanoic acid, 2-chloro-;2-Chlorobenzenepropanoic acid;3-(2-chlorophenyl)propanoic acid;3-(2-chlorophenyl)propanoate |
MF | C9H8ClO2 |
Berat Molekul | 183.6122 |
InChI | InChI=1/C9H9ClO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12)/p-1 |
CAS NO | 1643-28-3 |
Struktur Molekul | |
Titik didih | 306.6°C at 760 mmHg |
Titik nyala | 139.2°C |
Tekanan wap | 0.000333mmHg at 25°C |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall