ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
16325-01-2 nitro blue diformazan |
|
اسم المنتج | nitro blue diformazan |
الاسم بالانجليزية | nitro blue diformazan;p-Nitro blue tetrazolium, diformazan p-NBT, diformazan;p-Nitrotetrazolium Blue Diformazan;(E,E)-1,1'-(3,3'-dimethoxybiphenyl-4,4'-diyl)bis{[(Z)-[(4-nitrophenyl)hydrazono](phenyl)methyl]diazene};(E,E)-1,1'-(3,3'-dimethoxybiphenyl-4,4'-diyl)bis{[(E)-[(4-nitrophenyl)hydrazono](phenyl)methyl]diazene} |
الصيغة الجزيئية | C40H32N10O6 |
الوزن الجزيئي الغرامي | 748.7455 |
InChI | InChI=1/C40H32N10O6/c1-55-37-25-29(13-23-35(37)43-47-39(27-9-5-3-6-10-27)45-41-31-15-19-33(20-16-31)49(51)52)30-14-24-36(38(26-30)56-2)44-48-40(28-11-7-4-8-12-28)46-42-32-17-21-34(22-18-32)50(53)54/h3-26,41-42H,1-2H3/b45-39+,46-40+,47-43+,48-44+ |
إستراتيجية المساعدة القطرية | 16325-01-2 |
بنية جزيئية | ![]() |
كثافة | 1.33g/cm3 |
درجة الإنصهار | 257℃ |
نقطة الغليان | 892.8°C at 760 mmHg |
معامل الإنكسار | 1.667 |
نقطة الوميض | 493.7°C |
ضغط البخار | 1.53E-32mmHg at 25°C |
علامات على البضائع الخطرة | |
خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |