ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13679-72-6 2-acetyl-3-methylthiophene |
|
اسم المنتج | 2-acetyl-3-methylthiophene |
الاسم بالانجليزية | 2-acetyl-3-methylthiophene;1-(3-methylthiophen-2-yl)ethanone;2-acetyl-3-methyl thiophene |
الصيغة الجزيئية | C7H8OS |
الوزن الجزيئي الغرامي | 140.2028 |
InChI | InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
إستراتيجية المساعدة القطرية | 13679-72-6 |
المفوضية الأوروبية رقم | 237-179-1 |
بنية جزيئية | |
كثافة | 1.106g/cm3 |
نقطة الغليان | 214.9°C at 760 mmHg |
معامل الإنكسار | 1.535 |
نقطة الوميض | 92.3°C |
ضغط البخار | 0.152mmHg at 25°C |
خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
شروط الأمن | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |