ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
107-84-6 1-Chloro-3-methylbutane |
|
اسم المنتج | 1-Chloro-3-methylbutane |
الاسم بالانجليزية | 1-Chloro-3-methylbutane;Isoamyl chloride~Isopentyl chloride |
الصيغة الجزيئية | C5H11Cl |
الوزن الجزيئي الغرامي | 106.5938 |
InChI | InChI=1/C5H11Cl/c1-5(2)3-4-6/h5H,3-4H2,1-2H3 |
إستراتيجية المساعدة القطرية | 107-84-6 |
المفوضية الأوروبية رقم | 203-525-5 |
بنية جزيئية | |
كثافة | 0.867g/cm3 |
نقطة الغليان | 98.3°C at 760 mmHg |
معامل الإنكسار | 1.403 |
نقطة الوميض | 9.8°C |
ضغط البخار | 46.2mmHg at 25°C |
خطر المصطلحات | R11##Highly flammable.:; |
شروط الأمن | S16##Keep away from sources of ignition - No smoking.||S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |