ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Nitrophenyloxamic acid |
|
اسم المنتج | 4-Nitrophenyloxamic acid |
الاسم بالانجليزية | 4-Nitrophenyloxamic acid;4-Nitrooxanilic acid;[(4-nitrophenyl)amino](oxo)acetic acid |
الصيغة الجزيئية | C8H6N2O5 |
الوزن الجزيئي الغرامي | 210.1436 |
InChI | InChI=1/C8H6N2O5/c11-7(8(12)13)9-5-1-3-6(4-2-5)10(14)15/h1-4H,(H,9,11)(H,12,13) |
إستراتيجية المساعدة القطرية | 103-94-6 |
المفوضية الأوروبية رقم | 203-160-1 |
بنية جزيئية | |
كثافة | 1.629g/cm3 |
معامل الإنكسار | 1.678 |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |