102-86-3 Tri-n-hexylamine |
| اسم المنتج |
Tri-n-hexylamine |
| الاسم بالانجليزية |
Tri-n-hexylamine;1-Hexanamine, N,N-dihexyl-;AI3-16575;NSC 409786;Trihexylamine;N,N-dihexylhexan-1-amine;N,N-dihexylhexan-1-aminium |
| الصيغة الجزيئية |
C18H39N |
| الوزن الجزيئي الغرامي |
269.51436 |
| InChI |
InChI=1/C18H39N/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3/h4-18H2,1-3H3/p+1 |
| إستراتيجية المساعدة القطرية |
102-86-3 |
| المفوضية الأوروبية رقم |
203-062-9 |
| بنية جزيئية |
 |
| نقطة الغليان |
263.5°C at 760 mmHg |
| نقطة الوميض |
116.1°C |
| ضغط البخار |
0.0103mmHg at 25°C |
| علامات على البضائع الخطرة |
 Xi##Irritant:;
|
| خطر المصطلحات |
R22##Harmful if swallowed.||R34##Causes burns.||R51/53##Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:;
|
| شروط الأمن |
S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S28##After contact with skin, wash immediately with plenty of ...||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:;
|
| MSDS |
Material Safety Data Sheet |
SA ▼
