ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3-Nitroformanilide |
|
اسم المنتج | 3-Nitroformanilide |
الاسم بالانجليزية | 3-Nitroformanilide;N-(3-nitrophenyl)formamide |
الصيغة الجزيئية | C7H6N2O3 |
الوزن الجزيئي الغرامي | 166.1341 |
InChI | InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
إستراتيجية المساعدة القطرية | 102-38-5 |
بنية جزيئية | |
كثافة | 1.407g/cm3 |
نقطة الغليان | 368.5°C at 760 mmHg |
معامل الإنكسار | 1.641 |
نقطة الوميض | 176.7°C |
ضغط البخار | 1.27E-05mmHg at 25°C |
خطر المصطلحات | R20/22##Harmful by inhalation and if swallowed.:; |
شروط الأمن | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |