ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
101-99-5 N-Phenylurethane |
|
اسم المنتج | N-Phenylurethane |
الاسم بالانجليزية | N-Phenylurethane;Ethyl carbanilate~Ethyl N-phenylcarbamate;ethyl phenylcarbamate |
الصيغة الجزيئية | C9H11NO2 |
الوزن الجزيئي الغرامي | 165.1891 |
InChI | InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
إستراتيجية المساعدة القطرية | 101-99-5 |
المفوضية الأوروبية رقم | 202-995-9 |
بنية جزيئية | |
كثافة | 1.136g/cm3 |
نقطة الغليان | 238°C at 760 mmHg |
معامل الإنكسار | 1.558 |
نقطة الوميض | 79.2°C |
ضغط البخار | 0.0434mmHg at 25°C |
خطر المصطلحات | R40##Possible risks of irreversible effects.:; |
شروط الأمن | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |