ChemIndex - قاعدة بيانات CAS كيميائية مجانيةChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
m-Vinyltoluene |
|
اسم المنتج | m-Vinyltoluene |
الاسم بالانجليزية | m-Vinyltoluene;3-Methylstyrene;3-Vinyltoluene |
الصيغة الجزيئية | C9H10 |
الوزن الجزيئي الغرامي | 118.17 |
InChI | InChI=1/C9H10/c1-3-9-6-4-5-8(2)7-9/h3-7H,1H2,2H3 |
إستراتيجية المساعدة القطرية | 100-80-1 |
المفوضية الأوروبية رقم | 202-889-2 |
بنية جزيئية | |
كثافة | 170 |
نقطة الغليان | 171℃ |
خطر المصطلحات | R10##Flammable.||R20##Harmful by inhalation.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |