ChemIndex - Бесплатная база данных CAS по химическим веществамToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
347-55-7 2-(trifluoromethylthio)aniline |
|
Название продукта | 2-(trifluoromethylthio)aniline |
Английское название | 2-(trifluoromethylthio)aniline;2-Aminophenyl trifluoromethyl sulphide;4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoic acid |
Молекулярная формула | C11H11FO4 |
Молекулярный вес | 226.201 |
InChI | InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) |
Регистрационный номер CAS | 347-55-7 |
EINECS | 206-473-1 |
Молекулярная структура | |
Плотность | 1.279g/cm3 |
Точка кипения | 422.6°C at 760 mmHg |
Показатель преломления | 1.52 |
Температура вспышки | 209.4°C |
Давление пара | 6.78E-08mmHg at 25°C |
Риск коды | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Характеристики безопасности | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |