Chemindex > 700-96-9
PT ▼
700-96-9 3,4-Dimethoxythiophenol |
|
| Nome do produto | 3,4-Dimethoxythiophenol |
| Nome em inglês | 3,4-Dimethoxythiophenol;3,4-Dimethoxybenzenethiol |
| Fórmula molecular | C8H10O2S |
| Peso Molecular | 170.22 |
| InChI | InChI=1/C8H10O2S/c1-9-7-4-3-6(11)5-8(7)10-2/h3-5,11H,1-2H3 |
| CAS Registry Number | 700-96-9 |
| Estrutura Molecular |  |
| Densidade | 1.19 |
| Ponto de ebulição | 110℃(1 torr) |
| Códigos de risco | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/38##Irritating to eyes and skin.:; |
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Se você planeja obter produtos químicos da China, basta ir ao shopping ChemNet, obteremos o preço mais recente e competitivo dos fabricantes da China para você.Por favor, visite
ChemNet Mall
O serviço de banco de dados Chemical CAS é fornecido pela ChemIndex.com 