ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
616-04-6 1-Methylhydantoin |
|
Nome do produto | 1-Methylhydantoin |
Nome em inglês | 1-Methylhydantoin;1-methylimidazolidine-2,4-dione;3-methylimidazolidine-2,4-dione |
Fórmula molecular | C4H6N2O2 |
Peso Molecular | 114.1026 |
InChI | InChI=1/C4H6N2O2/c1-6-3(7)2-5-4(6)8/h2H2,1H3,(H,5,8) |
CAS Registry Number | 616-04-6 |
EINECS | 210-460-6 |
Estrutura Molecular | |
Densidade | 1.285g/cm3 |
Ponto de fusão | 156-160℃ |
índice de refração | 1.491 |
Descrição da Segurança | S24/25##Avoid contact with skin and eyes.:; |
MSDS |