ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
603-51-0 4,4-Diphenylsemicarbazide |
|
Nome do produto | 4,4-Diphenylsemicarbazide |
Nome em inglês | 4,4-Diphenylsemicarbazide;Hydrazinecarboxamide, N,N-diphenyl-;AI3-52365;NSC 47698;NSC 8717;Semicarbazide, 4,4-diphenyl- (8CI);N,N-diphenylhydrazinecarboxamide |
Fórmula molecular | C13H13N3O |
Peso Molecular | 227.2618 |
InChI | InChI=1/C13H13N3O/c14-15-13(17)16(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,14H2,(H,15,17) |
CAS Registry Number | 603-51-0 |
EINECS | 210-046-5 |
Estrutura Molecular | |
Densidade | 1.237g/cm3 |
Ponto de fusão | 147-151℃ |
índice de refração | 1.656 |
Descrição da Segurança | S24/25##Avoid contact with skin and eyes.:; |
MSDS |