ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
452-68-6 2-Fluoro-5-Iodotoluene |
|
Nome do produto | 2-Fluoro-5-Iodotoluene |
Nome em inglês | 2-Fluoro-5-Iodotoluene; |
Fórmula molecular | C7H6FI |
Peso Molecular | 236.02 |
InChI | InChI=1/C7H6FI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
CAS Registry Number | 452-68-6 |
EINECS | 207-206-1 |
Estrutura Molecular | |
Códigos de risco | R36/38##Irritating to eyes and skin.:; |
Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |