ChemIndex - Um banco de dados CAS químico gratuitoChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3-(3-Fluoro-4-methoxybenzoyl)propionic acid |
|
Nome do produto | 3-(3-Fluoro-4-methoxybenzoyl)propionic acid |
Nome em inglês | 3-(3-Fluoro-4-methoxybenzoyl)propionic acid; |
Fórmula molecular | C11H11FO4 |
Peso Molecular | 226.20 |
InChI | InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) |
CAS Registry Number | 347-63-7 |
EINECS | 206-474-7 |
Estrutura Molecular | |
Códigos de risco | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |