Chemindex > 116-25-6
PT ▼
1-(Hydroxymethyl)-5,5-dimethyl hydantoin |
|
| Nome do produto | 1-(Hydroxymethyl)-5,5-dimethyl hydantoin |
| Nome em inglês | 1-(Hydroxymethyl)-5,5-dimethyl hydantoin;1-(Hydroxymethyl)-5,5-dimethylhydantoin;5,5-Dimethyl-1-(hydroxymethyl)hydantoin;1-(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione;1-Hydroxymethyl-5,5-dimethylhydantoin;2,4-Imidazolidinedione, (hydroxymethyl)-5,5-dimethyl-;1-Hydroxymethyl-5,5-Dimethyl Hydantoin |
| Fórmula molecular | C6H10N2O3 |
| Peso Molecular | 158.1552 |
| InChI | InChI=1/C6H10N2O3/c1-6(2)4(10)7-5(11)8(6)3-9/h9H,3H2,1-2H3,(H,7,10,11) |
| CAS Registry Number | 116-25-6;27636-82-4 |
| EINECS | 204-132-1 |
| Estrutura Molecular |  |
| Densidade | 1.257g/cm3 |
| índice de refração | 1.493 |
| Códigos de risco | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- Se você planeja obter produtos químicos da China, basta ir ao shopping ChemNet, obteremos o preço mais recente e competitivo dos fabricantes da China para você.Por favor, visite
ChemNet Mall
O serviço de banco de dados Chemical CAS é fornecido pela ChemIndex.com 