ChemIndex - Um banco de dados CAS químico gratuitoChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
N-Carbamoylmaleamic acid |
|
Nome do produto | N-Carbamoylmaleamic acid |
Nome em inglês | N-Carbamoylmaleamic acid;Maleuric acid;Maleic acid monoureide~Maleuric acid;(2Z)-4-(carbamoylamino)-4-oxobut-2-enoic acid;(2E)-4-(carbamoylamino)-4-oxobut-2-enoic acid;4-(carbamoylamino)-4-oxobut-2-enoate |
Fórmula molecular | C5H5N2O4 |
Peso Molecular | 157.1047 |
InChI | InChI=1/C5H6N2O4/c6-5(11)7-3(8)1-2-4(9)10/h1-2H,(H,9,10)(H3,6,7,8,11)/p-1 |
CAS Registry Number | 105-61-3 |
EINECS | 203-314-8 |
Estrutura Molecular | |
Códigos de risco | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |